Compound ID | 3200
Synonym(s): Paramycin
Class: Mycolic acid synthesis inhibitor
Details of activity: | Active against Mycobacterium tuberculosis; mycobacterial folic acid synthesis inhibitor |
Combined with other compounds: | Yes |
Description: | Synthetic compound; prodrug; shows toxic side-effects such as gastrointestinal issues and intolerance during human clinical trials; second-line anti-TB drug |
Institute where first reported: | BRISTOL MYERS SQUIBB |
Year first mentioned: | 1946 |
Highest developmental phase: | Clinical Trial (1950; with streptomycin or isoniazid from 1950-1964) |
Development status: | Discontinued |
Chemical structure(s): | |
Canonical SMILES: | C1=C(C=C(C(=C1)C(=O)O)O)N |
Isomeric SMILES: | C1=CC(=C(C=C1N)O)C(=O)O |
InChI: | InChI=1S/C7H7NO3/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3,9H,8H2,(H,10,11) |
InChI Key: | WUBBRNOQWQTFEX-UHFFFAOYSA-N |
Structure link: | https://pubchem.ncbi.nlm.nih.gov/compound/4649 |