Compound ID | 708
Class: Phenylpyrrole
Spectrum of activity: | Gram-positive & Gram-negative |
Details of activity: | The base compound was synthesised from 3, 5-dichloroanisole which was then chemically manipulated to generate a number of analogs. Many demonstrated toxicity. The less chlorinated analogue had broad spectrum activity and reduced toxicity. |
Institute where first reported: | Wasada University, Japan |
Year first mentioned: | 1994 |
Highest developmental phase: | Preclinical |
Development status: | Inactive |
Chemical structure(s): | |
Canonical SMILES: | C1=CN(C2=C(C(=C(C=C2O)Cl)Cl)Cl)C(=C1Cl)Cl |
Isomeric SMILES: | C1=CN(C(=C1Cl)Cl)C2=C(C(=C(C=C2O)Cl)Cl)Cl |
InChI: | InChI=1S/C10H4Cl5NO/c11-4-1-2-16(10(4)15)9-6(17)3-5(12)7(13)8(9)14/h1-3,17H |
InChI Key: | VQUHAXJBUPCVDX-UHFFFAOYSA-N |
Structure link: | https://pubchem.ncbi.nlm.nih.gov/compound/125512 |
External links: | |
Guide to Pharmacology: | neopyrrolomycin |
Citations: |
|